About 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine
3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine (PubChem CID 45038124) has the molecular formula C11H11N5
and a molecular weight of 214.24 g/mol. Its IUPAC name is 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine.
Molecular Properties
| Compound Name | 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine |
| PubChem CID | 45038124 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine |
| SMILES | Cc1cnc2ccc3c(n[13c](N)n3C)c2n1 |
| InChI | InChI=1S/C11H11N5/c1-6-5-13-7-3-4-8-10(9(7)14-6)15-11(12)16(8)2/h3-5H,1-2H3,(H2,12,15)/i11+1 |
| InChIKey | DVCCCQNKIYNAKB-KHWBWMQUSA-N |
| XLogP | 1.41 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine?
The IUPAC name of 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine (CID 45038124) is 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine.
What is the SMILES notation for 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine?
The canonical SMILES for 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine is Cc1cnc2ccc3c(n[13c](N)n3C)c2n1.
What is the InChIKey of 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine?
The InChIKey is DVCCCQNKIYNAKB-KHWBWMQUSA-N. The full InChI is InChI=1S/C11H11N5/c1-6-5-13-7-3-4-8-10(9(7)14-6)15-11(12)16(8)2/h3-5H,1-2H3,(H2,12,15)/i11+1.
What are the key properties of 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine?
3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine has a molecular weight of 214.24 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethyl(213C)imidazolo[4,5-f]quinoxalin-2-amine is sourced from PubChem (CID 45038124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).