About 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione
6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione (PubChem CID 45038142) has the molecular formula C6H12N4O2
and a molecular weight of 172.19 g/mol. Its IUPAC name is 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione |
| PubChem CID | 45038142 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione |
| SMILES | CNC1C(=O)NC(=O)N(C)C1N |
| InChI | InChI=1S/C6H12N4O2/c1-8-3-4(7)10(2)6(12)9-5(3)11/h3-4,8H,7H2,1-2H3,(H,9,11,12) |
| InChIKey | SIYXRVXURMPMCM-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione?
The IUPAC name of 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione (CID 45038142) is 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione.
What is the SMILES notation for 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione?
The canonical SMILES for 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione is CNC1C(=O)NC(=O)N(C)C1N.
What is the InChIKey of 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione?
The InChIKey is SIYXRVXURMPMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O2/c1-8-3-4(7)10(2)6(12)9-5(3)11/h3-4,8H,7H2,1-2H3,(H,9,11,12).
What are the key properties of 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione?
6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione has a molecular weight of 172.19 g/mol, XLogP of -1.96, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-methyl-5-(methylamino)-1,3-diazinane-2,4-dione is sourced from PubChem (CID 45038142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).