C13H16N2O3 — CID 45038204
2,3-dihydro-1,4-benzodioxin-3-yl-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)methanone (PubChem CID 45038204) has the molecular formula C13H16N2O3 and a molecular weight of 256.33 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-3-yl-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-3-yl-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 45038204 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-yl-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)methanone |
| SMILES | [2H]C1([2H])NC([2H])([2H])C([2H])([2H])N(C(=O)C2COc3ccccc3O2)C1([2H])[2H] |
| InChI | InChI=1S/C13H16N2O3/c16-13(15-7-5-14-6-8-15)12-9-17-10-3-1-2-4-11(10)18-12/h1-4,12,14H,5-9H2/i5D2,6D2,7D2,8D2 |
| InChIKey | FLUPDJNTYCSBJZ-YEBVBAJPSA-N |
| XLogP | 0.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |