C9H18N2O2 — CID 45038414
tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate (PubChem CID 45038414) has the molecular formula C9H18N2O2 and a molecular weight of 194.30 g/mol. Its IUPAC name is tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate.
| Compound Name | tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 45038414 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.19 |
| IUPAC Name | tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate |
| SMILES | [2H]C1([2H])NC([2H])([2H])C([2H])([2H])N(C(=O)OC(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C9H18N2O2/c1-9(2,3)13-8(12)11-6-4-10-5-7-11/h10H,4-7H2,1-3H3/i4D2,5D2,6D2,7D2 |
| InChIKey | CWXPZXBSDSIRCS-DUSUNJSHSA-N |
| XLogP | 0.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |