C8H12N4O2 — CID 45038534
1,3,7-tris(trideuteriomethyl)-4,5-dihydropurine-2,6-dione (PubChem CID 45038534) has the molecular formula C8H12N4O2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1,3,7-tris(trideuteriomethyl)-4,5-dihydropurine-2,6-dione.
| Compound Name | 1,3,7-tris(trideuteriomethyl)-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 45038534 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1,3,7-tris(trideuteriomethyl)-4,5-dihydropurine-2,6-dione |
| SMILES | [2H]C([2H])([2H])N1C(=O)C2C(N=CN2C([2H])([2H])[2H])N(C([2H])([2H])[2H])C1=O |
| InChI | InChI=1S/C8H12N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4-6H,1-3H3/i1D3,2D3,3D3 |
| InChIKey | PKROKIUCEJBAQW-GQALSZNTSA-N |
| XLogP | -0.82 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |