C13H18N2O — CID 45038912
4-[2-(3,3,3-trideuteriopropylamino)ethyl]-1,3-dihydroindol-2-one (PubChem CID 45038912) has the molecular formula C13H18N2O and a molecular weight of 221.32 g/mol. Its IUPAC name is 4-[2-(3,3,3-trideuteriopropylamino)ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-[2-(3,3,3-trideuteriopropylamino)ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 45038912 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 4-[2-(3,3,3-trideuteriopropylamino)ethyl]-1,3-dihydroindol-2-one |
| SMILES | [2H]C([2H])([2H])CCNCCc1cccc2c1CC(=O)N2 |
| InChI | InChI=1S/C13H18N2O/c1-2-7-14-8-6-10-4-3-5-12-11(10)9-13(16)15-12/h3-5,14H,2,6-9H2,1H3,(H,15,16)/i1D3 |
| InChIKey | VKDWFHAQOZYATG-FIBGUPNXSA-N |
| XLogP | 1.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|