C11H20O4 — CID 45038999
diethyl 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)propanedioate (PubChem CID 45038999) has the molecular formula C11H20O4 and a molecular weight of 225.33 g/mol. Its IUPAC name is diethyl 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)propanedioate.
| Compound Name | diethyl 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)propanedioate |
|---|---|
| PubChem CID | 45038999 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | diethyl 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)propanedioate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C11H20O4/c1-4-7-8-9(10(12)14-5-2)11(13)15-6-3/h9H,4-8H2,1-3H3/i1D3,4D2,7D2,8D2 |
| InChIKey | RPNFNBGRHCUORR-GQWSVURBSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|