C3H4O3 — CID 45039094
4,4,5,5-tetradeuterio-1,3-dioxolan-2-one (PubChem CID 45039094) has the molecular formula C3H4O3 and a molecular weight of 92.09 g/mol. Its IUPAC name is 4,4,5,5-tetradeuterio-1,3-dioxolan-2-one.
| Compound Name | 4,4,5,5-tetradeuterio-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 45039094 |
| Molecular Formula | C3H4O3 |
| Molecular Weight | 92.09 g/mol |
| Exact Mass | 92.04 |
| IUPAC Name | 4,4,5,5-tetradeuterio-1,3-dioxolan-2-one |
| SMILES | [2H]C1([2H])OC(=O)OC1([2H])[2H] |
| InChI | InChI=1S/C3H4O3/c4-3-5-1-2-6-3/h1-2H2/i1D2,2D2 |
| InChIKey | KMTRUDSVKNLOMY-LNLMKGTHSA-N |
| XLogP | 0.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 92.09 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |