C11H22FNO4P- — CID 45039166
4-[ethoxy(fluoro)phosphoryl]oxy-2,2,6,6-tetramethyl-1-oxidopiperidine (PubChem CID 45039166) has the molecular formula C11H22FNO4P- and a molecular weight of 282.27 g/mol. Its IUPAC name is 4-[ethoxy(fluoro)phosphoryl]oxy-2,2,6,6-tetramethyl-1-oxidopiperidine.
| Compound Name | 4-[ethoxy(fluoro)phosphoryl]oxy-2,2,6,6-tetramethyl-1-oxidopiperidine |
|---|---|
| PubChem CID | 45039166 |
| Molecular Formula | C11H22FNO4P- |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 4-[ethoxy(fluoro)phosphoryl]oxy-2,2,6,6-tetramethyl-1-oxidopiperidine |
| SMILES | CCOP(=O)(F)OC1CC(C)(C)N([O-])C(C)(C)C1 |
| InChI | InChI=1S/C11H22FNO4P/c1-6-16-18(12,15)17-9-7-10(2,3)13(14)11(4,5)8-9/h9H,6-8H2,1-5H3/q-1 |
| InChIKey | PZIKKRYLXYKTAV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|