C3H6N2O — CID 45039203
4,4,5,5-tetradeuterioimidazolidin-2-one (PubChem CID 45039203) has the molecular formula C3H6N2O and a molecular weight of 90.12 g/mol. Its IUPAC name is 4,4,5,5-tetradeuterioimidazolidin-2-one.
| Compound Name | 4,4,5,5-tetradeuterioimidazolidin-2-one |
|---|---|
| PubChem CID | 45039203 |
| Molecular Formula | C3H6N2O |
| Molecular Weight | 90.12 g/mol |
| Exact Mass | 90.07 |
| IUPAC Name | 4,4,5,5-tetradeuterioimidazolidin-2-one |
| SMILES | [2H]C1([2H])NC(=O)NC1([2H])[2H] |
| InChI | InChI=1S/C3H6N2O/c6-3-4-1-2-5-3/h1-2H2,(H2,4,5,6)/i1D2,2D2 |
| InChIKey | YAMHXTCMCPHKLN-LNLMKGTHSA-N |
| XLogP | -0.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 90.12 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |