C19H19ClN2O — CID 45039437
13-chloro-2-(3,3,5,5-tetradeuteriopiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-ol (PubChem CID 45039437) has the molecular formula C19H19ClN2O and a molecular weight of 330.85 g/mol. Its IUPAC name is 13-chloro-2-(3,3,5,5-tetradeuteriopiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-ol.
| Compound Name | 13-chloro-2-(3,3,5,5-tetradeuteriopiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-ol |
|---|---|
| PubChem CID | 45039437 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 330.85 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 13-chloro-2-(3,3,5,5-tetradeuteriopiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-ol |
| SMILES | [2H]C1([2H])CNCC([2H])([2H])C1=C1c2ccc(Cl)cc2CCc2cc(O)cnc21 |
| InChI | InChI=1S/C19H19ClN2O/c20-15-3-4-17-13(9-15)1-2-14-10-16(23)11-22-19(14)18(17)12-5-7-21-8-6-12/h3-4,9-11,21,23H,1-2,5-8H2/i5D2,6D2 |
| InChIKey | NDFMTPISBHBIKE-NZLXMSDQSA-N |
| XLogP | 3.72 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |