C3H8O3S2 — CID 45039447
1,1,2,2-tetradeuterio-2-methylsulfonylsulfanylethanol (PubChem CID 45039447) has the molecular formula C3H8O3S2 and a molecular weight of 160.25 g/mol. Its IUPAC name is 1,1,2,2-tetradeuterio-2-methylsulfonylsulfanylethanol.
| Compound Name | 1,1,2,2-tetradeuterio-2-methylsulfonylsulfanylethanol |
|---|---|
| PubChem CID | 45039447 |
| Molecular Formula | C3H8O3S2 |
| Molecular Weight | 160.25 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | 1,1,2,2-tetradeuterio-2-methylsulfonylsulfanylethanol |
| SMILES | [2H]C([2H])(O)C([2H])([2H])SS(C)(=O)=O |
| InChI | InChI=1S/C3H8O3S2/c1-8(5,6)7-3-2-4/h4H,2-3H2,1H3/i2D2,3D2 |
| InChIKey | AGPKHLPHPSLRED-RRVWJQJTSA-N |
| XLogP | -0.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|