About 5-methyl-1,2-dihydropyridin-2-ol
5-methyl-1,2-dihydropyridin-2-ol (PubChem CID 45039472) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 5-methyl-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | 5-methyl-1,2-dihydropyridin-2-ol |
| PubChem CID | 45039472 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 5-methyl-1,2-dihydropyridin-2-ol |
| SMILES | CC1=CNC(O)C=C1 |
| InChI | InChI=1S/C6H9NO/c1-5-2-3-6(8)7-4-5/h2-4,6-8H,1H3 |
| InChIKey | PFMCRSIJVUUWRU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,2-dihydropyridin-2-ol?
The IUPAC name of 5-methyl-1,2-dihydropyridin-2-ol (CID 45039472) is 5-methyl-1,2-dihydropyridin-2-ol.
What is the SMILES notation for 5-methyl-1,2-dihydropyridin-2-ol?
The canonical SMILES for 5-methyl-1,2-dihydropyridin-2-ol is CC1=CNC(O)C=C1.
What is the InChIKey of 5-methyl-1,2-dihydropyridin-2-ol?
The InChIKey is PFMCRSIJVUUWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c1-5-2-3-6(8)7-4-5/h2-4,6-8H,1H3.
What are the key properties of 5-methyl-1,2-dihydropyridin-2-ol?
5-methyl-1,2-dihydropyridin-2-ol has a molecular weight of 111.14 g/mol, XLogP of 0.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 45039472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).