C13H13Cl2N3O3 — CID 45039590
3-(3,5-dichloro-2,4,6-trideuteriophenyl)-2,4-dioxo-N-propan-2-ylimidazolidine-1-carboxamide (PubChem CID 45039590) has the molecular formula C13H13Cl2N3O3 and a molecular weight of 333.19 g/mol. Its IUPAC name is 3-(3,5-dichloro-2,4,6-trideuteriophenyl)-2,4-dioxo-N-propan-2-ylimidazolidine-1-carboxamide.
| Compound Name | 3-(3,5-dichloro-2,4,6-trideuteriophenyl)-2,4-dioxo-N-propan-2-ylimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 45039590 |
| Molecular Formula | C13H13Cl2N3O3 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3-(3,5-dichloro-2,4,6-trideuteriophenyl)-2,4-dioxo-N-propan-2-ylimidazolidine-1-carboxamide |
| SMILES | [2H]c1c(Cl)c([2H])c(N2C(=O)CN(C(=O)NC(C)C)C2=O)c([2H])c1Cl |
| InChI | InChI=1S/C13H13Cl2N3O3/c1-7(2)16-12(20)17-6-11(19)18(13(17)21)10-4-8(14)3-9(15)5-10/h3-5,7H,6H2,1-2H3,(H,16,20)/i3D,4D,5D |
| InChIKey | ONUFESLQCSAYKA-QGZYMEECSA-N |
| XLogP | 2.88 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|