C11H13Cl2N5O4S — CID 45039646
6-(2,3-Dichlorophenyl)-1,2,4-triazine-3,5-diamine isethionate (PubChem CID 45039646) has the molecular formula C11H13Cl2N5O4S and a molecular weight of 382.20 g/mol. Its IUPAC name is 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine;2-hydroxyethanesulfonic acid.
| Compound Name | 6-(2,3-Dichlorophenyl)-1,2,4-triazine-3,5-diamine isethionate |
|---|---|
| PubChem CID | 45039646 |
| Molecular Formula | C11H13Cl2N5O4S |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine;2-hydroxyethanesulfonic acid |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(N=C(N=N2)N)N.C(CS(=O)(=O)O)O |
| InChI | InChI=1S/C9H7Cl2N5.C2H6O4S/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7;3-1-2-7(4,5)6/h1-3H,(H4,12,13,14,16);3H,1-2H2,(H,4,5,6) |
| InChIKey | CJIDZLNMKONKAD-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 174.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | 359 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|