C8H14N2O2 — CID 45039653
(2S)-4,4,4-trideuterio-2-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 45039653) has the molecular formula C8H14N2O2 and a molecular weight of 173.23 g/mol. Its IUPAC name is (2S)-4,4,4-trideuterio-2-(2-oxopyrrolidin-1-yl)butanamide.
| Compound Name | (2S)-4,4,4-trideuterio-2-(2-oxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 45039653 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (2S)-4,4,4-trideuterio-2-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | [2H]C([2H])([2H])C[C@@H](C(N)=O)N1CCCC1=O |
| InChI | InChI=1S/C8H14N2O2/c1-2-6(8(9)12)10-5-3-4-7(10)11/h6H,2-5H2,1H3,(H2,9,12)/t6-/m0/s1/i1D3 |
| InChIKey | HPHUVLMMVZITSG-FYFSCIFKSA-N |
| XLogP | -0.13 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |