C3H6N6 — CID 45039688
2-N,2-N,4-N,4-N,6-N,6-N-hexadeuterio-1,3,5-triazine-2,4,6-triamine (PubChem CID 45039688) has the molecular formula C3H6N6 and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexadeuterio-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexadeuterio-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 45039688 |
| Molecular Formula | C3H6N6 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexadeuterio-1,3,5-triazine-2,4,6-triamine |
| SMILES | [2H]N([2H])c1nc(N([2H])[2H])nc(N([2H])[2H])n1 |
| InChI | InChI=1S/C3H6N6/c4-1-7-2(5)9-3(6)8-1/h(H6,4,5,6,7,8,9)/i/hD6 |
| InChIKey | JDSHMPZPIAZGSV-YIKVAAQNSA-N |
| XLogP | -1.38 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |