C6H14O — CID 45039770
2,2-bis(trideuteriomethyl)butan-1-ol (PubChem CID 45039770) has the molecular formula C6H14O and a molecular weight of 108.21 g/mol. Its IUPAC name is 2,2-bis(trideuteriomethyl)butan-1-ol.
| Compound Name | 2,2-bis(trideuteriomethyl)butan-1-ol |
|---|---|
| PubChem CID | 45039770 |
| Molecular Formula | C6H14O |
| Molecular Weight | 108.21 g/mol |
| Exact Mass | 108.14 |
| IUPAC Name | 2,2-bis(trideuteriomethyl)butan-1-ol |
| SMILES | [2H]C([2H])([2H])C(CC)(CO)C([2H])([2H])[2H] |
| InChI | InChI=1S/C6H14O/c1-4-6(2,3)5-7/h7H,4-5H2,1-3H3/i2D3,3D3 |
| InChIKey | XRMVWAKMXZNZIL-XERRXZQWSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |