C18H20N2 — CID 45039931
5-(trideuteriomethyl)-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene (PubChem CID 45039931) has the molecular formula C18H20N2 and a molecular weight of 267.39 g/mol. Its IUPAC name is 5-(trideuteriomethyl)-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene.
| Compound Name | 5-(trideuteriomethyl)-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene |
|---|---|
| PubChem CID | 45039931 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 5-(trideuteriomethyl)-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene |
| SMILES | [2H]C([2H])([2H])N1CCN2c3ccccc3Cc3ccccc3C2C1 |
| InChI | InChI=1S/C18H20N2/c1-19-10-11-20-17-9-5-3-7-15(17)12-14-6-2-4-8-16(14)18(20)13-19/h2-9,18H,10-13H2,1H3/i1D3 |
| InChIKey | UEQUQVLFIPOEMF-FIBGUPNXSA-N |
| XLogP | 3.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |