C10H22O4S2 — CID 45040361
1,1-bis[methyl(methylidene)-λ4-sulfanyl]hexane-2,3,4,5-tetrol (PubChem CID 45040361) has the molecular formula C10H22O4S2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1,1-bis[methyl(methylidene)-λ4-sulfanyl]hexane-2,3,4,5-tetrol.
| Compound Name | 1,1-bis[methyl(methylidene)-λ4-sulfanyl]hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 45040361 |
| Molecular Formula | C10H22O4S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1,1-bis[methyl(methylidene)-λ4-sulfanyl]hexane-2,3,4,5-tetrol |
| SMILES | C=S(C)C(C(O)C(O)C(O)C(C)O)S(=C)C |
| InChI | InChI=1S/C10H22O4S2/c1-6(11)7(12)8(13)9(14)10(15(2)3)16(4)5/h6-14H,2,4H2,1,3,5H3 |
| InChIKey | KAIQWIHXUXGKGN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|