C8H15NO3 — CID 45040453
(1S,2R,8R,8aR)-6,7-ditritio-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol (PubChem CID 45040453) has the molecular formula C8H15NO3 and a molecular weight of 177.23 g/mol. Its IUPAC name is (1S,2R,8R,8aR)-6,7-ditritio-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol.
| Compound Name | (1S,2R,8R,8aR)-6,7-ditritio-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol |
|---|---|
| PubChem CID | 45040453 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (1S,2R,8R,8aR)-6,7-ditritio-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol |
| SMILES | [3H]C1CN2C[C@@H](O)[C@@H](O)[C@H]2[C@H](O)C1[3H] |
| InChI | InChI=1S/C8H15NO3/c10-5-2-1-3-9-4-6(11)8(12)7(5)9/h5-8,10-12H,1-4H2/t5-,6-,7-,8-/m1/s1/i1T,2T/t1?,2?,5-,6-,7-,8- |
| InChIKey | FXUAIOOAOAVCGD-MIEHMAQMSA-N |
| XLogP | -1.45 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |