About (3-methoxyphenyl)methyl thiocyanate
(3-methoxyphenyl)methyl thiocyanate (PubChem CID 45040724) has the molecular formula C9H9NOS
and a molecular weight of 179.24 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl thiocyanate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl thiocyanate |
| PubChem CID | 45040724 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | (3-methoxyphenyl)methyl thiocyanate |
| SMILES | COc1cccc(CSC#N)c1 |
| InChI | InChI=1S/C9H9NOS/c1-11-9-4-2-3-8(5-9)6-12-7-10/h2-5H,6H2,1H3 |
| InChIKey | BAWQGDICORFTBO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxyphenyl)methyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl thiocyanate?
The IUPAC name of (3-methoxyphenyl)methyl thiocyanate (CID 45040724) is (3-methoxyphenyl)methyl thiocyanate.
What is the SMILES notation for (3-methoxyphenyl)methyl thiocyanate?
The canonical SMILES for (3-methoxyphenyl)methyl thiocyanate is COc1cccc(CSC#N)c1.
What is the InChIKey of (3-methoxyphenyl)methyl thiocyanate?
The InChIKey is BAWQGDICORFTBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOS/c1-11-9-4-2-3-8(5-9)6-12-7-10/h2-5H,6H2,1H3.
What are the key properties of (3-methoxyphenyl)methyl thiocyanate?
(3-methoxyphenyl)methyl thiocyanate has a molecular weight of 179.24 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl thiocyanate is sourced from PubChem (CID 45040724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).