C21H31N3O11S — CID 45042437
ethyl 2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]-4,5-dimethylthiophene-3-carboxylate;oxalic acid (PubChem CID 45042437) has the molecular formula C21H31N3O11S and a molecular weight of 533.56 g/mol. Its IUPAC name is ethyl 2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]-4,5-dimethylthiophene-3-carboxylate;oxalic acid.
| Compound Name | ethyl 2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]-4,5-dimethylthiophene-3-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 45042437 |
| Molecular Formula | C21H31N3O11S |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | ethyl 2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]-4,5-dimethylthiophene-3-carboxylate;oxalic acid |
| SMILES | CCOC(=O)c1c(NC(=O)CN2CCN(CC)CC2)sc(C)c1C.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H27N3O3S.2C2H2O4/c1-5-19-7-9-20(10-8-19)11-14(21)18-16-15(17(22)23-6-2)12(3)13(4)24-16;2*3-1(4)2(5)6/h5-11H2,1-4H3,(H,18,21);2*(H,3,4)(H,5,6) |
| InChIKey | WHDUCNRKXXQZOT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 211.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|