C21H15F3INOS — CID 45043069
3-methyl-2-[(E)-2-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]ethenyl]-1,3-benzothiazol-3-ium iodide (PubChem CID 45043069) has the molecular formula C21H15F3INOS and a molecular weight of 513.32 g/mol. Its IUPAC name is 3-methyl-2-[(E)-2-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]ethenyl]-1,3-benzothiazol-3-ium iodide.
| Compound Name | 3-methyl-2-[(E)-2-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]ethenyl]-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 45043069 |
| Molecular Formula | C21H15F3INOS |
| Molecular Weight | 513.32 g/mol |
| Exact Mass | 512.99 |
| IUPAC Name | 3-methyl-2-[(E)-2-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]ethenyl]-1,3-benzothiazol-3-ium iodide |
| SMILES | C[n+]1c(/C=C/c2ccc(-c3cccc(C(F)(F)F)c3)o2)sc2ccccc21.[I-] |
| InChI | InChI=1S/C21H15F3NOS.HI/c1-25-17-7-2-3-8-19(17)27-20(25)12-10-16-9-11-18(26-16)14-5-4-6-15(13-14)21(22,23)24;/h2-13H,1H3;1H/q+1;/p-1/b12-10+; |
| InChIKey | NZLYZXAMHIOZSK-VHPXAQPISA-M |
| XLogP | 3.18 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|