About 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol
1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol (PubChem CID 45043194) has the molecular formula C9H10ClNO
and a molecular weight of 183.64 g/mol. Its IUPAC name is 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 45043194 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol |
| SMILES | NC1c2cc(Cl)ccc2CC1O |
| InChI | InChI=1S/C9H10ClNO/c10-6-2-1-5-3-8(12)9(11)7(5)4-6/h1-2,4,8-9,12H,3,11H2 |
| InChIKey | JQEZHCRRILWBQT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol?
The IUPAC name of 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol (CID 45043194) is 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol is NC1c2cc(Cl)ccc2CC1O.
What is the InChIKey of 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol?
The InChIKey is JQEZHCRRILWBQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO/c10-6-2-1-5-3-8(12)9(11)7(5)4-6/h1-2,4,8-9,12H,3,11H2.
What are the key properties of 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol?
1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol has a molecular weight of 183.64 g/mol, XLogP of 1.26, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-6-chloro-2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 45043194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).