C23H25ClN4O4 — CID 4504332
2-chloro-N-[6-[(2-hydroxy-5-methoxy-1-methylindol-3-yl)diazenyl]-6-oxohexyl]benzamide (PubChem CID 4504332) has the molecular formula C23H25ClN4O4 and a molecular weight of 456.93 g/mol. Its IUPAC name is 2-chloro-N-[6-[(2-hydroxy-5-methoxy-1-methylindol-3-yl)diazenyl]-6-oxohexyl]benzamide.
| Compound Name | 2-chloro-N-[6-[(2-hydroxy-5-methoxy-1-methylindol-3-yl)diazenyl]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 4504332 |
| Molecular Formula | C23H25ClN4O4 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-chloro-N-[6-[(2-hydroxy-5-methoxy-1-methylindol-3-yl)diazenyl]-6-oxohexyl]benzamide |
| SMILES | COc1ccc2c(c1)c(/N=N/C(=O)CCCCCNC(=O)c1ccccc1Cl)c(O)n2C |
| InChI | InChI=1S/C23H25ClN4O4/c1-28-19-12-11-15(32-2)14-17(19)21(23(28)31)27-26-20(29)10-4-3-7-13-25-22(30)16-8-5-6-9-18(16)24/h5-6,8-9,11-12,14,31H,3-4,7,10,13H2,1-2H3,(H,25,30)/b27-26+ |
| InChIKey | INAOCPXNKUTKDU-CYYJNZCTSA-N |
| XLogP | 5.15 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|