C25H29Br3ClN5O2 — CID 45043343
1-N,1-N-diethyl-4-N-[6-nitro-2-[(E)-2-(2,4,6-tribromophenyl)ethenyl]quinazolin-4-yl]pentane-1,4-diamine;hydrochloride (PubChem CID 45043343) has the molecular formula C25H29Br3ClN5O2 and a molecular weight of 706.71 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-[6-nitro-2-[(E)-2-(2,4,6-tribromophenyl)ethenyl]quinazolin-4-yl]pentane-1,4-diamine;hydrochloride.
| Compound Name | 1-N,1-N-diethyl-4-N-[6-nitro-2-[(E)-2-(2,4,6-tribromophenyl)ethenyl]quinazolin-4-yl]pentane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 45043343 |
| Molecular Formula | C25H29Br3ClN5O2 |
| Molecular Weight | 706.71 g/mol |
| Exact Mass | 702.96 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-[6-nitro-2-[(E)-2-(2,4,6-tribromophenyl)ethenyl]quinazolin-4-yl]pentane-1,4-diamine;hydrochloride |
| SMILES | CCN(CC)CCCC(C)Nc1nc(/C=C/c2c(Br)cc(Br)cc2Br)nc2ccc([N+](=O)[O-])cc12.Cl |
| InChI | InChI=1S/C25H28Br3N5O2.ClH/c1-4-32(5-2)12-6-7-16(3)29-25-20-15-18(33(34)35)8-10-23(20)30-24(31-25)11-9-19-21(27)13-17(26)14-22(19)28;/h8-11,13-16H,4-7,12H2,1-3H3,(H,29,30,31);1H/b11-9+; |
| InChIKey | STQXHGHYEXKBOJ-LBEJWNQZSA-N |
| XLogP | 8.34 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.71 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|