C48H52Br2N2P2 — CID 45043539
[2,3-dimethyl-3-(3,4,4-trimethyl-5-triphenylphosphaniumyl-3H-pyrazol-2-yl)butan-2-yl]-triphenylphosphanium dibromide (PubChem CID 45043539) has the molecular formula C48H52Br2N2P2 and a molecular weight of 878.71 g/mol. Its IUPAC name is [2,3-dimethyl-3-(3,4,4-trimethyl-5-triphenylphosphaniumyl-3H-pyrazol-2-yl)butan-2-yl]-triphenylphosphanium dibromide.
| Compound Name | [2,3-dimethyl-3-(3,4,4-trimethyl-5-triphenylphosphaniumyl-3H-pyrazol-2-yl)butan-2-yl]-triphenylphosphanium dibromide |
|---|---|
| PubChem CID | 45043539 |
| Molecular Formula | C48H52Br2N2P2 |
| Molecular Weight | 878.71 g/mol |
| Exact Mass | 876.20 |
| IUPAC Name | [2,3-dimethyl-3-(3,4,4-trimethyl-5-triphenylphosphaniumyl-3H-pyrazol-2-yl)butan-2-yl]-triphenylphosphanium dibromide |
| SMILES | CC1N(C(C)(C)C(C)(C)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)N=C([P+](c2ccccc2)(c2ccccc2)c2ccccc2)C1(C)C.[Br-].[Br-] |
| InChI | InChI=1S/C48H52N2P2.2BrH/c1-38-46(2,3)45(51(39-26-14-8-15-27-39,40-28-16-9-17-29-40)41-30-18-10-19-31-41)49-50(38)47(4,5)48(6,7)52(42-32-20-11-21-33-42,43-34-22-12-23-35-43)44-36-24-13-25-37-44;;/h8-38H,1-7H3;2*1H/q+2;;/p-2 |
| InChIKey | QDUQCFDELWBMKZ-UHFFFAOYSA-L |
| XLogP | 3.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|