C34H36N2 — CID 45043559
(1R,12S)-15,16-dibenzyl-1,3,5,8,10,12-hexamethyl-15,16-diazapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,6,9,13-pentaene (PubChem CID 45043559) has the molecular formula C34H36N2 and a molecular weight of 472.68 g/mol. Its IUPAC name is (1R,12S)-15,16-dibenzyl-1,3,5,8,10,12-hexamethyl-15,16-diazapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,6,9,13-pentaene.
| Compound Name | (1R,12S)-15,16-dibenzyl-1,3,5,8,10,12-hexamethyl-15,16-diazapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,6,9,13-pentaene |
|---|---|
| PubChem CID | 45043559 |
| Molecular Formula | C34H36N2 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | (1R,12S)-15,16-dibenzyl-1,3,5,8,10,12-hexamethyl-15,16-diazapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,6,9,13-pentaene |
| SMILES | Cc1c2c(c(C)c3c1[C@]1(C)C=C[C@@]3(C)N1Cc1ccccc1)C1(C)C=CC2(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C34H36N2/c1-23-27-29(33(5)19-17-31(27,3)35(33)21-25-13-9-7-10-14-25)24(2)30-28(23)32(4)18-20-34(30,6)36(32)22-26-15-11-8-12-16-26/h7-20H,21-22H2,1-6H3/t31-,32?,33+,34? |
| InChIKey | BXCLCQQOJIDXOR-DXOXEQLUSA-N |
| XLogP | 7.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|