C29H48O3 — CID 45044363
[(5S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl] acetate (PubChem CID 45044363) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is [(5S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl] acetate.
| Compound Name | [(5S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl] acetate |
|---|---|
| PubChem CID | 45044363 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | [(5S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl] acetate |
| SMILES | CC(=O)OC1C(=O)C2C3CCC([C@H](C)CCCC(C)C)C3(C)CCC2C2(C)CCCC[C@H]12 |
| InChI | InChI=1S/C29H48O3/c1-18(2)10-9-11-19(3)21-13-14-22-25-23(15-17-29(21,22)6)28(5)16-8-7-12-24(28)27(26(25)31)32-20(4)30/h18-19,21-25,27H,7-17H2,1-6H3/t19-,21?,22?,23?,24-,25?,27?,28?,29?/m1/s1 |
| InChIKey | VTTIIPCPXXZOKN-ZEUVQDJJSA-N |
| XLogP | 7.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |