C20H21N3O4 — CID 4504457
N-(1-ethyl-2-hydroxy-5-methoxyindol-3-yl)imino-2-(2-methylphenoxy)acetamide (PubChem CID 4504457) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-(1-ethyl-2-hydroxy-5-methoxyindol-3-yl)imino-2-(2-methylphenoxy)acetamide.
| Compound Name | N-(1-ethyl-2-hydroxy-5-methoxyindol-3-yl)imino-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 4504457 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-(1-ethyl-2-hydroxy-5-methoxyindol-3-yl)imino-2-(2-methylphenoxy)acetamide |
| SMILES | CCn1c(O)c(/N=N/C(=O)COc2ccccc2C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C20H21N3O4/c1-4-23-16-10-9-14(26-3)11-15(16)19(20(23)25)22-21-18(24)12-27-17-8-6-5-7-13(17)2/h5-11,25H,4,12H2,1-3H3/b22-21+ |
| InChIKey | JYSAYGLDKDHOJB-QURGRASLSA-N |
| XLogP | 4.37 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|