C20H28O6 — CID 45044749
(17R)-3,5-dihydroxy-13-methyl-1,2,3,4,6,7,8,9,11,12,16,17-dodecahydrocyclopenta[a]phenanthrene-10,17-dicarboxylic acid (PubChem CID 45044749) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (17R)-3,5-dihydroxy-13-methyl-1,2,3,4,6,7,8,9,11,12,16,17-dodecahydrocyclopenta[a]phenanthrene-10,17-dicarboxylic acid.
| Compound Name | (17R)-3,5-dihydroxy-13-methyl-1,2,3,4,6,7,8,9,11,12,16,17-dodecahydrocyclopenta[a]phenanthrene-10,17-dicarboxylic acid |
|---|---|
| PubChem CID | 45044749 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (17R)-3,5-dihydroxy-13-methyl-1,2,3,4,6,7,8,9,11,12,16,17-dodecahydrocyclopenta[a]phenanthrene-10,17-dicarboxylic acid |
| SMILES | CC12CCC3C(CCC4(O)CC(O)CCC34C(=O)O)C1=CC[C@H]2C(=O)O |
| InChI | InChI=1S/C20H28O6/c1-18-7-6-14-12(13(18)2-3-15(18)16(22)23)5-8-19(26)10-11(21)4-9-20(14,19)17(24)25/h2,11-12,14-15,21,26H,3-10H2,1H3,(H,22,23)(H,24,25)/t11?,12?,14?,15-,18?,19?,20?/m0/s1 |
| InChIKey | BQNJRUIPWDGFHP-BFWSBPIESA-N |
| XLogP | 2.19 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|