C14H7N3O7S3 — CID 45044894
2,4,6-trinitrophenol;3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 45044894) has the molecular formula C14H7N3O7S3 and a molecular weight of 425.43 g/mol. Its IUPAC name is 2,4,6-trinitrophenol;3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 2,4,6-trinitrophenol;3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 45044894 |
| Molecular Formula | C14H7N3O7S3 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 424.94 |
| IUPAC Name | 2,4,6-trinitrophenol;3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1cc2sc3ccsc3c2s1 |
| InChI | InChI=1S/C8H4S3.C6H3N3O7/c1-3-9-7-5(1)11-6-2-4-10-8(6)7;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-4H;1-2,10H |
| InChIKey | ULSCFFIIWMOZSX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|