About (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate
(5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate (PubChem CID 45046563) has the molecular formula C27H20BClF4NPS
and a molecular weight of 543.76 g/mol. Its IUPAC name is (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate.
Molecular Properties
| Compound Name | (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate |
| PubChem CID | 45046563 |
| Molecular Formula | C27H20BClF4NPS |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate |
| SMILES | Clc1sc(-c2ccccc2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C27H20ClNPS.BF4/c28-25-26(29-27(31-25)21-13-5-1-6-14-21)30(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3,4)5/h1-20H;/q+1;-1 |
| InChIKey | LDIBAFCUHKRJMT-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate?
The IUPAC name of (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate (CID 45046563) is (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate.
What is the SMILES notation for (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate?
The canonical SMILES for (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate is Clc1sc(-c2ccccc2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[B-](F)(F)F.
What is the InChIKey of (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate?
The InChIKey is LDIBAFCUHKRJMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20ClNPS.BF4/c28-25-26(29-27(31-25)21-13-5-1-6-14-21)30(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3,4)5/h1-20H;/q+1;-1.
What are the key properties of (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate?
(5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate has a molecular weight of 543.76 g/mol, XLogP of 7.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2-phenyl-1,3-thiazol-4-yl)-triphenylphosphanium tetrafluoroborate is sourced from PubChem (CID 45046563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).