C29H42N4O2 — CID 45046620
N-[(E)-(4-tert-butylphenyl)methylideneamino]-5-(4-octoxyphenyl)pyrazolidine-3-carboxamide (PubChem CID 45046620) has the molecular formula C29H42N4O2 and a molecular weight of 478.68 g/mol. Its IUPAC name is N-[(E)-(4-tert-butylphenyl)methylideneamino]-5-(4-octoxyphenyl)pyrazolidine-3-carboxamide.
| Compound Name | N-[(E)-(4-tert-butylphenyl)methylideneamino]-5-(4-octoxyphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 45046620 |
| Molecular Formula | C29H42N4O2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | N-[(E)-(4-tert-butylphenyl)methylideneamino]-5-(4-octoxyphenyl)pyrazolidine-3-carboxamide |
| SMILES | CCCCCCCCOc1ccc(C2CC(C(=O)N/N=C/c3ccc(C(C)(C)C)cc3)NN2)cc1 |
| InChI | InChI=1S/C29H42N4O2/c1-5-6-7-8-9-10-19-35-25-17-13-23(14-18-25)26-20-27(32-31-26)28(34)33-30-21-22-11-15-24(16-12-22)29(2,3)4/h11-18,21,26-27,31-32H,5-10,19-20H2,1-4H3,(H,33,34)/b30-21+ |
| InChIKey | GPMWEDBKRZSVPQ-MWAVMZGNSA-N |
| XLogP | 5.78 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|