C24H21ClN2O6S2 — CID 45047430
acetic acid;4-[(5Z)-5-[1-[(4-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 45047430) has the molecular formula C24H21ClN2O6S2 and a molecular weight of 533.03 g/mol. Its IUPAC name is acetic acid;4-[(5Z)-5-[1-[(4-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | acetic acid;4-[(5Z)-5-[1-[(4-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 45047430 |
| Molecular Formula | C24H21ClN2O6S2 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | acetic acid;4-[(5Z)-5-[1-[(4-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | CC(=O)O.O=C(O)CCCN1C(=O)/C(=C2/C(=O)N(Cc3ccc(Cl)cc3)c3ccccc32)SC1=S |
| InChI | InChI=1S/C22H17ClN2O4S2.C2H4O2/c23-14-9-7-13(8-10-14)12-25-16-5-2-1-4-15(16)18(20(25)28)19-21(29)24(22(30)31-19)11-3-6-17(26)27;1-2(3)4/h1-2,4-5,7-10H,3,6,11-12H2,(H,26,27);1H3,(H,3,4)/b19-18-; |
| InChIKey | IDWLOIZGLJTPDS-TVWXOORISA-N |
| XLogP | 4.41 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|