C40H39FN6O3S — CID 45047439
(5Z)-2-(4-benzylpiperazin-1-yl)-5-[[3-[4-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one;N,N-dimethylformamide (PubChem CID 45047439) has the molecular formula C40H39FN6O3S and a molecular weight of 702.86 g/mol. Its IUPAC name is (5Z)-2-(4-benzylpiperazin-1-yl)-5-[[3-[4-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one;N,N-dimethylformamide.
| Compound Name | (5Z)-2-(4-benzylpiperazin-1-yl)-5-[[3-[4-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one;N,N-dimethylformamide |
|---|---|
| PubChem CID | 45047439 |
| Molecular Formula | C40H39FN6O3S |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.28 |
| IUPAC Name | (5Z)-2-(4-benzylpiperazin-1-yl)-5-[[3-[4-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one;N,N-dimethylformamide |
| SMILES | CN(C)C=O.O=C1N=C(N2CCN(Cc3ccccc3)CC2)S/C1=C\c1cn(-c2ccccc2)nc1-c1ccc(OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C37H32FN5O2S.C3H7NO/c38-33-14-8-7-11-29(33)26-45-32-17-15-28(16-18-32)35-30(25-43(40-35)31-12-5-2-6-13-31)23-34-36(44)39-37(46-34)42-21-19-41(20-22-42)24-27-9-3-1-4-10-27;1-4(2)3-5/h1-18,23,25H,19-22,24,26H2;3H,1-2H3/b34-23-; |
| InChIKey | VBDMRANWXDBPNO-AJLKPRBGSA-N |
| XLogP | 6.75 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|