About (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate
(1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate (PubChem CID 45048104) has the molecular formula C22H19Cl3NO5P
and a molecular weight of 514.73 g/mol. Its IUPAC name is (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate.
Molecular Properties
| Compound Name | (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate |
| PubChem CID | 45048104 |
| Molecular Formula | C22H19Cl3NO5P |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate |
| SMILES | CC(=O)NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H18Cl2NOP.ClHO4/c1-17(26)25-22(21(23)24)27(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;2-1(3,4)5/h2-16H,1H3;(H,2,3,4,5) |
| InChIKey | VMRGQGWZMUPHTN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate?
The IUPAC name of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate (CID 45048104) is (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate.
What is the SMILES notation for (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate?
The canonical SMILES for (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate is CC(=O)NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate?
The InChIKey is VMRGQGWZMUPHTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2NOP.ClHO4/c1-17(26)25-22(21(23)24)27(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;2-1(3,4)5/h2-16H,1H3;(H,2,3,4,5).
What are the key properties of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate?
(1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate has a molecular weight of 514.73 g/mol, XLogP of -0.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium perchlorate is sourced from PubChem (CID 45048104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).