C23H30ClNO6 — CID 45048318
6-(1-ethyl-3-phenyl-5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)hexanoic acid perchlorate (PubChem CID 45048318) has the molecular formula C23H30ClNO6 and a molecular weight of 451.95 g/mol. Its IUPAC name is 6-(1-ethyl-3-phenyl-5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)hexanoic acid perchlorate.
| Compound Name | 6-(1-ethyl-3-phenyl-5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)hexanoic acid perchlorate |
|---|---|
| PubChem CID | 45048318 |
| Molecular Formula | C23H30ClNO6 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 6-(1-ethyl-3-phenyl-5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)hexanoic acid perchlorate |
| SMILES | CCc1c2c(cc(-c3ccccc3)[n+]1CCCCCC(=O)O)CCCC2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H29NO2.ClHO4/c1-2-21-20-14-9-8-13-19(20)17-22(18-11-5-3-6-12-18)24(21)16-10-4-7-15-23(25)26;2-1(3,4)5/h3,5-6,11-12,17H,2,4,7-10,13-16H2,1H3;(H,2,3,4,5) |
| InChIKey | KXCNRSVVAHJNJZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|