About 5-phenyl-1H-1,2,4-triazole;hydrochloride
5-phenyl-1H-1,2,4-triazole;hydrochloride (PubChem CID 45048587) has the molecular formula C8H8ClN3
and a molecular weight of 181.63 g/mol. Its IUPAC name is 5-phenyl-1H-1,2,4-triazole;hydrochloride.
Molecular Properties
| Compound Name | 5-phenyl-1H-1,2,4-triazole;hydrochloride |
| PubChem CID | 45048587 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 5-phenyl-1H-1,2,4-triazole;hydrochloride |
| SMILES | Cl.c1ccc(-c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C8H7N3.ClH/c1-2-4-7(5-3-1)8-9-6-10-11-8;/h1-6H,(H,9,10,11);1H |
| InChIKey | PCGMSGNJMRRMAA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenyl-1H-1,2,4-triazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1H-1,2,4-triazole;hydrochloride?
The IUPAC name of 5-phenyl-1H-1,2,4-triazole;hydrochloride (CID 45048587) is 5-phenyl-1H-1,2,4-triazole;hydrochloride.
What is the SMILES notation for 5-phenyl-1H-1,2,4-triazole;hydrochloride?
The canonical SMILES for 5-phenyl-1H-1,2,4-triazole;hydrochloride is Cl.c1ccc(-c2ncn[nH]2)cc1.
What is the InChIKey of 5-phenyl-1H-1,2,4-triazole;hydrochloride?
The InChIKey is PCGMSGNJMRRMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.ClH/c1-2-4-7(5-3-1)8-9-6-10-11-8;/h1-6H,(H,9,10,11);1H.
What are the key properties of 5-phenyl-1H-1,2,4-triazole;hydrochloride?
5-phenyl-1H-1,2,4-triazole;hydrochloride has a molecular weight of 181.63 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1H-1,2,4-triazole;hydrochloride is sourced from PubChem (CID 45048587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).