About methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine
methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine (PubChem CID 45048588) has the molecular formula C11H14N4O4S
and a molecular weight of 298.32 g/mol. Its IUPAC name is methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine.
Molecular Properties
| Compound Name | methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine |
| PubChem CID | 45048588 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine |
| SMILES | COS(=O)(=O)[O-].Cn1c[n+](/N=C\c2ccccc2)cn1 |
| InChI | InChI=1S/C10H11N4.CH4O4S/c1-13-9-14(8-12-13)11-7-10-5-3-2-4-6-10;1-5-6(2,3)4/h2-9H,1H3;1H3,(H,2,3,4)/q+1;/p-1/b11-7-; |
| InChIKey | IIWBMXWHLGOCLJ-AJULUCINSA-M |
| XLogP | -0.32 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine?
The IUPAC name of methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine (CID 45048588) is methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine.
What is the SMILES notation for methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine?
The canonical SMILES for methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine is COS(=O)(=O)[O-].Cn1c[n+](/N=C\c2ccccc2)cn1.
What is the InChIKey of methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine?
The InChIKey is IIWBMXWHLGOCLJ-AJULUCINSA-M. The full InChI is InChI=1S/C10H11N4.CH4O4S/c1-13-9-14(8-12-13)11-7-10-5-3-2-4-6-10;1-5-6(2,3)4/h2-9H,1H3;1H3,(H,2,3,4)/q+1;/p-1/b11-7-;.
What are the key properties of methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine?
methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine has a molecular weight of 298.32 g/mol, XLogP of -0.32, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl sulfate;(Z)-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-1-phenylmethanimine is sourced from PubChem (CID 45048588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).