C21H26Br2N2O3 — CID 45048914
methyl (19R)-16-bromo-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrobromide (PubChem CID 45048914) has the molecular formula C21H26Br2N2O3 and a molecular weight of 514.26 g/mol. Its IUPAC name is methyl (19R)-16-bromo-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrobromide.
| Compound Name | methyl (19R)-16-bromo-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrobromide |
|---|---|
| PubChem CID | 45048914 |
| Molecular Formula | C21H26Br2N2O3 |
| Molecular Weight | 514.26 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | methyl (19R)-16-bromo-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrobromide |
| SMILES | Br.COC(=O)[C@H]1C(O)CC(Br)C2CN3CCc4c([nH]c5ccccc45)C3CC21 |
| InChI | InChI=1S/C21H25BrN2O3.BrH/c1-27-21(26)19-13-8-17-20-12(11-4-2-3-5-16(11)23-20)6-7-24(17)10-14(13)15(22)9-18(19)25;/h2-5,13-15,17-19,23,25H,6-10H2,1H3;1H/t13?,14?,15?,17?,18?,19-;/m1./s1 |
| InChIKey | UJUBHAREMBAMBJ-KKTXMKARSA-N |
| XLogP | 3.60 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|