C36H40N2O4 — CID 45049116
2,3-diphenylbutanoic acid;(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methanol (PubChem CID 45049116) has the molecular formula C36H40N2O4 and a molecular weight of 564.73 g/mol. Its IUPAC name is 2,3-diphenylbutanoic acid;(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | 2,3-diphenylbutanoic acid;(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 45049116 |
| Molecular Formula | C36H40N2O4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 2,3-diphenylbutanoic acid;(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccc(OC)cc12.CC(c1ccccc1)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O2.C16H16O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;1-12(13-8-4-2-5-9-13)15(16(17)18)14-10-6-3-7-11-14/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2-12,15H,1H3,(H,17,18) |
| InChIKey | KETASNAZJCDNEF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|