About 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide
4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide (PubChem CID 45049218) has the molecular formula C16H18INO2
and a molecular weight of 383.23 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide.
Molecular Properties
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide |
| PubChem CID | 45049218 |
| Molecular Formula | C16H18INO2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide |
| SMILES | COc1ccc(C=Cc2cc[n+](C)cc2)cc1OC.[I-] |
| InChI | InChI=1S/C16H18NO2.HI/c1-17-10-8-13(9-11-17)4-5-14-6-7-15(18-2)16(12-14)19-3;/h4-12H,1-3H3;1H/q+1;/p-1 |
| InChIKey | XHAHTBOQHQENRU-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide?
The IUPAC name of 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide (CID 45049218) is 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide.
What is the SMILES notation for 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide?
The canonical SMILES for 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide is COc1ccc(C=Cc2cc[n+](C)cc2)cc1OC.[I-].
What is the InChIKey of 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide?
The InChIKey is XHAHTBOQHQENRU-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H18NO2.HI/c1-17-10-8-13(9-11-17)4-5-14-6-7-15(18-2)16(12-14)19-3;/h4-12H,1-3H3;1H/q+1;/p-1.
What are the key properties of 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide?
4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide has a molecular weight of 383.23 g/mol, XLogP of -0.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide is sourced from PubChem (CID 45049218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).