About sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate
sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate (PubChem CID 45049241) has the molecular formula C12H8Cl2NNaO4S
and a molecular weight of 356.16 g/mol. Its IUPAC name is sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate.
Molecular Properties
| Compound Name | sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate |
| PubChem CID | 45049241 |
| Molecular Formula | C12H8Cl2NNaO4S |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate |
| SMILES | Nc1ccc(Oc2c(Cl)cc(Cl)cc2S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C12H9Cl2NO4S.Na/c13-7-5-10(14)12(11(6-7)20(16,17)18)19-9-3-1-8(15)2-4-9;/h1-6H,15H2,(H,16,17,18);/q;+1/p-1 |
| InChIKey | ILLHEZFNLOZAKQ-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate?
The IUPAC name of sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate (CID 45049241) is sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate.
What is the SMILES notation for sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate?
The canonical SMILES for sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate is Nc1ccc(Oc2c(Cl)cc(Cl)cc2S(=O)(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate?
The InChIKey is ILLHEZFNLOZAKQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H9Cl2NO4S.Na/c13-7-5-10(14)12(11(6-7)20(16,17)18)19-9-3-1-8(15)2-4-9;/h1-6H,15H2,(H,16,17,18);/q;+1/p-1.
What are the key properties of sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate?
sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate has a molecular weight of 356.16 g/mol, XLogP of 0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(4-aminophenoxy)-3,5-dichlorobenzenesulfonate is sourced from PubChem (CID 45049241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).