C37H49BN2O2 — CID 45049301
2-hydroxyethyl-dimethyl-(2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-yl)azanium;tetraphenylboranuide (PubChem CID 45049301) has the molecular formula C37H49BN2O2 and a molecular weight of 564.62 g/mol. Its IUPAC name is 2-hydroxyethyl-dimethyl-(2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-yl)azanium;tetraphenylboranuide.
| Compound Name | 2-hydroxyethyl-dimethyl-(2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-yl)azanium;tetraphenylboranuide |
|---|---|
| PubChem CID | 45049301 |
| Molecular Formula | C37H49BN2O2 |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | 2-hydroxyethyl-dimethyl-(2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-yl)azanium;tetraphenylboranuide |
| SMILES | CC1(C)CC([N+](C)(C)CCO)CC(C)(C)[NH+]1[O-].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C13H29N2O2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-12(2)9-11(15(5,6)7-8-16)10-13(3,4)14(12)17/h1-20H;11,14,16H,7-10H2,1-6H3/q-1;+1 |
| InChIKey | BPRROKAMEVZPEM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 47.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|