About 4-methylpyridazine-3,6-dione
4-methylpyridazine-3,6-dione (PubChem CID 45049309) has the molecular formula C5H4N2O2
and a molecular weight of 124.10 g/mol. Its IUPAC name is 4-methylpyridazine-3,6-dione.
Molecular Properties
| Compound Name | 4-methylpyridazine-3,6-dione |
| PubChem CID | 45049309 |
| Molecular Formula | C5H4N2O2 |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 4-methylpyridazine-3,6-dione |
| SMILES | CC1=CC(=O)N=NC1=O |
| InChI | InChI=1S/C5H4N2O2/c1-3-2-4(8)6-7-5(3)9/h2H,1H3 |
| InChIKey | KCFIRVDEKAERQV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpyridazine-3,6-dione?
The IUPAC name of 4-methylpyridazine-3,6-dione (CID 45049309) is 4-methylpyridazine-3,6-dione.
What is the SMILES notation for 4-methylpyridazine-3,6-dione?
The canonical SMILES for 4-methylpyridazine-3,6-dione is CC1=CC(=O)N=NC1=O.
What is the InChIKey of 4-methylpyridazine-3,6-dione?
The InChIKey is KCFIRVDEKAERQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2/c1-3-2-4(8)6-7-5(3)9/h2H,1H3.
What are the key properties of 4-methylpyridazine-3,6-dione?
4-methylpyridazine-3,6-dione has a molecular weight of 124.10 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpyridazine-3,6-dione is sourced from PubChem (CID 45049309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).