C7H5F7N2O2 — CID 45049472
2,2,3,3,4,4,4-heptafluorobutanoic acid;1H-imidazole (PubChem CID 45049472) has the molecular formula C7H5F7N2O2 and a molecular weight of 282.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutanoic acid;1H-imidazole.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid;1H-imidazole |
|---|---|
| PubChem CID | 45049472 |
| Molecular Formula | C7H5F7N2O2 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid;1H-imidazole |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)F.c1c[nH]cn1 |
| InChI | InChI=1S/C4HF7O2.C3H4N2/c5-2(6,1(12)13)3(7,8)4(9,10)11;1-2-5-3-4-1/h(H,12,13);1-3H,(H,4,5) |
| InChIKey | KRMUCZMDHPIKES-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|