About N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride
N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride (PubChem CID 45049608) has the molecular formula C17H22Cl2N2
and a molecular weight of 325.28 g/mol. Its IUPAC name is N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride |
| PubChem CID | 45049608 |
| Molecular Formula | C17H22Cl2N2 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride |
| SMILES | CN(C)CCNC1c2ccccc2-c2ccccc21.Cl.Cl |
| InChI | InChI=1S/C17H20N2.2ClH/c1-19(2)12-11-18-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17;;/h3-10,17-18H,11-12H2,1-2H3;2*1H |
| InChIKey | LSBLPFULLJWBED-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride?
The IUPAC name of N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride (CID 45049608) is N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride.
What is the SMILES notation for N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride?
The canonical SMILES for N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride is CN(C)CCNC1c2ccccc2-c2ccccc21.Cl.Cl.
What is the InChIKey of N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride?
The InChIKey is LSBLPFULLJWBED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2.2ClH/c1-19(2)12-11-18-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17;;/h3-10,17-18H,11-12H2,1-2H3;2*1H.
What are the key properties of N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride?
N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride has a molecular weight of 325.28 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9H-fluoren-9-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 45049608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).