About 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc
2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc (PubChem CID 45050017) has the molecular formula C21H16Cl2N2O2Zn
and a molecular weight of 464.67 g/mol. Its IUPAC name is 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc.
Molecular Properties
| Compound Name | 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc |
| PubChem CID | 45050017 |
| Molecular Formula | C21H16Cl2N2O2Zn |
| Molecular Weight | 464.67 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc |
| SMILES | Cl[Zn]Cl.O=C1NC(C(=O)c2ccccc2)(c2ccccc2)Nc2ccccc21 |
| InChI | InChI=1S/C21H16N2O2.2ClH.Zn/c24-19(15-9-3-1-4-10-15)21(16-11-5-2-6-12-16)22-18-14-8-7-13-17(18)20(25)23-21;;;/h1-14,22H,(H,23,25);2*1H;/q;;;+2/p-2 |
| InChIKey | JOJWRGIBHGOMTI-UHFFFAOYSA-L |
| XLogP | 4.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc?
The IUPAC name of 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc (CID 45050017) is 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc.
What is the SMILES notation for 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc?
The canonical SMILES for 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc is Cl[Zn]Cl.O=C1NC(C(=O)c2ccccc2)(c2ccccc2)Nc2ccccc21.
What is the InChIKey of 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc?
The InChIKey is JOJWRGIBHGOMTI-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H16N2O2.2ClH.Zn/c24-19(15-9-3-1-4-10-15)21(16-11-5-2-6-12-16)22-18-14-8-7-13-17(18)20(25)23-21;;;/h1-14,22H,(H,23,25);2*1H;/q;;;+2/p-2.
What are the key properties of 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc?
2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc has a molecular weight of 464.67 g/mol, XLogP of 4.95, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoyl-2-phenyl-1,3-dihydroquinazolin-4-one;dichlorozinc is sourced from PubChem (CID 45050017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).